C11H9F3N2O2 — CID 59034244
5-methylidene-2,6-dioxo-1-propyl-4-(trifluoromethyl)pyridine-3-carbonitrile (PubChem CID 59034244) has the molecular formula C11H9F3N2O2 and a molecular weight of 258.20 g/mol. Its IUPAC name is 5-methylidene-2,6-dioxo-1-propyl-4-(trifluoromethyl)pyridine-3-carbonitrile.
| Compound Name | 5-methylidene-2,6-dioxo-1-propyl-4-(trifluoromethyl)pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 59034244 |
| Molecular Formula | C11H9F3N2O2 |
| Molecular Weight | 258.20 g/mol |
| Exact Mass | 258.06 |
| IUPAC Name | 5-methylidene-2,6-dioxo-1-propyl-4-(trifluoromethyl)pyridine-3-carbonitrile |
| SMILES | C=C1C(=O)N(CCC)C(=O)C(C#N)=C1C(F)(F)F |
| InChI | InChI=1S/C11H9F3N2O2/c1-3-4-16-9(17)6(2)8(11(12,13)14)7(5-15)10(16)18/h2-4H2,1H3 |
| InChIKey | WEGDPIFYXJECFF-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 61.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.20 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|