C9H5F3N2O2 — CID 142172938
1-methyl-5-methylidene-2,6-dioxo-4-(trifluoromethyl)pyridine-3-carbonitrile (PubChem CID 142172938) has the molecular formula C9H5F3N2O2 and a molecular weight of 230.14 g/mol. Its IUPAC name is 1-methyl-5-methylidene-2,6-dioxo-4-(trifluoromethyl)pyridine-3-carbonitrile.
| Compound Name | 1-methyl-5-methylidene-2,6-dioxo-4-(trifluoromethyl)pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 142172938 |
| Molecular Formula | C9H5F3N2O2 |
| Molecular Weight | 230.14 g/mol |
| Exact Mass | 230.03 |
| IUPAC Name | 1-methyl-5-methylidene-2,6-dioxo-4-(trifluoromethyl)pyridine-3-carbonitrile |
| SMILES | C=C1C(=O)N(C)C(=O)C(C#N)=C1C(F)(F)F |
| InChI | InChI=1S/C9H5F3N2O2/c1-4-6(9(10,11)12)5(3-13)8(16)14(2)7(4)15/h1H2,2H3 |
| InChIKey | PTNGEUGLQHEZQE-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 61.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.14 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|