C8H6N2O2 — CID 172676178
1-methyl-5-methylidene-2,6-dioxopyridine-3-carbonitrile (PubChem CID 172676178) has the molecular formula C8H6N2O2 and a molecular weight of 162.15 g/mol. Its IUPAC name is 1-methyl-5-methylidene-2,6-dioxopyridine-3-carbonitrile.
| Compound Name | 1-methyl-5-methylidene-2,6-dioxopyridine-3-carbonitrile |
|---|---|
| PubChem CID | 172676178 |
| Molecular Formula | C8H6N2O2 |
| Molecular Weight | 162.15 g/mol |
| Exact Mass | 162.04 |
| IUPAC Name | 1-methyl-5-methylidene-2,6-dioxopyridine-3-carbonitrile |
| SMILES | C=C1C=C(C#N)C(=O)N(C)C1=O |
| InChI | InChI=1S/C8H6N2O2/c1-5-3-6(4-9)8(12)10(2)7(5)11/h3H,1H2,2H3 |
| InChIKey | SVRHHOCTTCDKJP-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 61.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.15 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|