C14H18O3S — CID 91992795
(2S,3S,5S)-5-(benzenesulfonyl)-3-methyl-2-prop-2-enyloxolane (PubChem CID 91992795) has the molecular formula C14H18O3S and a molecular weight of 266.36 g/mol. Its IUPAC name is (2S,3S,5S)-5-(benzenesulfonyl)-3-methyl-2-prop-2-enyloxolane.
| Compound Name | (2S,3S,5S)-5-(benzenesulfonyl)-3-methyl-2-prop-2-enyloxolane |
|---|---|
| PubChem CID | 91992795 |
| Molecular Formula | C14H18O3S |
| Molecular Weight | 266.36 g/mol |
| Exact Mass | 266.10 |
| IUPAC Name | (2S,3S,5S)-5-(benzenesulfonyl)-3-methyl-2-prop-2-enyloxolane |
| SMILES | C=CC[C@@H]1O[C@@H](S(=O)(=O)c2ccccc2)C[C@@H]1C |
| InChI | InChI=1S/C14H18O3S/c1-3-7-13-11(2)10-14(17-13)18(15,16)12-8-5-4-6-9-12/h3-6,8-9,11,13-14H,1,7,10H2,2H3/t11-,13-,14-/m0/s1 |
| InChIKey | BPIMFQBNTYDKRD-UBHSHLNASA-N |
| XLogP | 2.79 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.36 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|