C12H14 — CID 91999195
(4E,5E)-4,5-di(ethylidene)octa-2,6-diyne (PubChem CID 91999195) has the molecular formula C12H14 and a molecular weight of 158.24 g/mol. Its IUPAC name is (4E,5E)-4,5-di(ethylidene)octa-2,6-diyne.
| Compound Name | (4E,5E)-4,5-di(ethylidene)octa-2,6-diyne |
|---|---|
| PubChem CID | 91999195 |
| Molecular Formula | C12H14 |
| Molecular Weight | 158.24 g/mol |
| Exact Mass | 158.11 |
| IUPAC Name | (4E,5E)-4,5-di(ethylidene)octa-2,6-diyne |
| SMILES | CC#CC(=C\C)/C(C#CC)=C/C |
| InChI | InChI=1S/C12H14/c1-5-9-11(7-3)12(8-4)10-6-2/h7-8H,1-4H3/b11-7+,12-8+ |
| InChIKey | DLCOALBJQHQANI-MKICQXMISA-N |
| XLogP | 2.93 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.24 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|