C19H25FN2O4 — CID 9202015
[2-[tert-butyl-[2-(4-fluoroanilino)-2-oxoethyl]amino]-2-oxoethyl] cyclobutanecarboxylate (PubChem CID 9202015) has the molecular formula C19H25FN2O4 and a molecular weight of 364.42 g/mol. Its IUPAC name is [2-[tert-butyl-[2-(4-fluoroanilino)-2-oxoethyl]amino]-2-oxoethyl] cyclobutanecarboxylate.
| Compound Name | [2-[tert-butyl-[2-(4-fluoroanilino)-2-oxoethyl]amino]-2-oxoethyl] cyclobutanecarboxylate |
|---|---|
| PubChem CID | 9202015 |
| Molecular Formula | C19H25FN2O4 |
| Molecular Weight | 364.42 g/mol |
| Exact Mass | 364.18 |
| IUPAC Name | [2-[tert-butyl-[2-(4-fluoroanilino)-2-oxoethyl]amino]-2-oxoethyl] cyclobutanecarboxylate |
| SMILES | CC(C)(C)N(CC(=O)Nc1ccc(F)cc1)C(=O)COC(=O)C1CCC1 |
| InChI | InChI=1S/C19H25FN2O4/c1-19(2,3)22(17(24)12-26-18(25)13-5-4-6-13)11-16(23)21-15-9-7-14(20)8-10-15/h7-10,13H,4-6,11-12H2,1-3H3,(H,21,23) |
| InChIKey | PDHOAPZIBMNTKE-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.42 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |