C23H29NO6 — CID 9203477
[2-oxo-2-[3-(2,3,5-trimethylphenoxy)propylamino]ethyl] 2,3-dimethoxybenzoate (PubChem CID 9203477) has the molecular formula C23H29NO6 and a molecular weight of 415.49 g/mol. Its IUPAC name is [2-oxo-2-[3-(2,3,5-trimethylphenoxy)propylamino]ethyl] 2,3-dimethoxybenzoate.
| Compound Name | [2-oxo-2-[3-(2,3,5-trimethylphenoxy)propylamino]ethyl] 2,3-dimethoxybenzoate |
|---|---|
| PubChem CID | 9203477 |
| Molecular Formula | C23H29NO6 |
| Molecular Weight | 415.49 g/mol |
| Exact Mass | 415.20 |
| IUPAC Name | [2-oxo-2-[3-(2,3,5-trimethylphenoxy)propylamino]ethyl] 2,3-dimethoxybenzoate |
| SMILES | COc1cccc(C(=O)OCC(=O)NCCCOc2cc(C)cc(C)c2C)c1OC |
| InChI | InChI=1S/C23H29NO6/c1-15-12-16(2)17(3)20(13-15)29-11-7-10-24-21(25)14-30-23(26)18-8-6-9-19(27-4)22(18)28-5/h6,8-9,12-13H,7,10-11,14H2,1-5H3,(H,24,25) |
| InChIKey | DUSFFLODZTZYJM-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.49 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|