C13H17F3N3O+ — CID 9204634
N-(4-methylpiperazin-4-ium-1-yl)-4-(trifluoromethyl)benzamide (PubChem CID 9204634) has the molecular formula C13H17F3N3O+ and a molecular weight of 288.29 g/mol. Its IUPAC name is N-(4-methylpiperazin-4-ium-1-yl)-4-(trifluoromethyl)benzamide.
| Compound Name | N-(4-methylpiperazin-4-ium-1-yl)-4-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 9204634 |
| Molecular Formula | C13H17F3N3O+ |
| Molecular Weight | 288.29 g/mol |
| Exact Mass | 288.13 |
| IUPAC Name | N-(4-methylpiperazin-4-ium-1-yl)-4-(trifluoromethyl)benzamide |
| SMILES | C[NH+]1CCN(NC(=O)c2ccc(C(F)(F)F)cc2)CC1 |
| InChI | InChI=1S/C13H16F3N3O/c1-18-6-8-19(9-7-18)17-12(20)10-2-4-11(5-3-10)13(14,15)16/h2-5H,6-9H2,1H3,(H,17,20)/p+1 |
| InChIKey | HMKZFELMONZKCP-UHFFFAOYSA-O |
| XLogP | 0.18 |
| TPSA | 36.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.29 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |