C14H22N3OS+ — CID 9205344
N-(4-methylpiperazin-4-ium-1-yl)-4-(methylsulfanylmethyl)benzamide (PubChem CID 9205344) has the molecular formula C14H22N3OS+ and a molecular weight of 280.42 g/mol. Its IUPAC name is N-(4-methylpiperazin-4-ium-1-yl)-4-(methylsulfanylmethyl)benzamide.
| Compound Name | N-(4-methylpiperazin-4-ium-1-yl)-4-(methylsulfanylmethyl)benzamide |
|---|---|
| PubChem CID | 9205344 |
| Molecular Formula | C14H22N3OS+ |
| Molecular Weight | 280.42 g/mol |
| Exact Mass | 280.15 |
| IUPAC Name | N-(4-methylpiperazin-4-ium-1-yl)-4-(methylsulfanylmethyl)benzamide |
| SMILES | CSCc1ccc(C(=O)NN2CC[NH+](C)CC2)cc1 |
| InChI | InChI=1S/C14H21N3OS/c1-16-7-9-17(10-8-16)15-14(18)13-5-3-12(4-6-13)11-19-2/h3-6H,7-11H2,1-2H3,(H,15,18)/p+1 |
| InChIKey | SATHHPBSFPRNIV-UHFFFAOYSA-O |
| XLogP | 0.02 |
| TPSA | 36.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.42 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |