C22H28N3O2+ — CID 9205532
2-(4-acetylpiperazin-1-ium-1-yl)-N-benzyl-N-(3-methylphenyl)acetamide (PubChem CID 9205532) has the molecular formula C22H28N3O2+ and a molecular weight of 366.49 g/mol. Its IUPAC name is 2-(4-acetylpiperazin-1-ium-1-yl)-N-benzyl-N-(3-methylphenyl)acetamide.
| Compound Name | 2-(4-acetylpiperazin-1-ium-1-yl)-N-benzyl-N-(3-methylphenyl)acetamide |
|---|---|
| PubChem CID | 9205532 |
| Molecular Formula | C22H28N3O2+ |
| Molecular Weight | 366.49 g/mol |
| Exact Mass | 366.22 |
| IUPAC Name | 2-(4-acetylpiperazin-1-ium-1-yl)-N-benzyl-N-(3-methylphenyl)acetamide |
| SMILES | CC(=O)N1CC[NH+](CC(=O)N(Cc2ccccc2)c2cccc(C)c2)CC1 |
| InChI | InChI=1S/C22H27N3O2/c1-18-7-6-10-21(15-18)25(16-20-8-4-3-5-9-20)22(27)17-23-11-13-24(14-12-23)19(2)26/h3-10,15H,11-14,16-17H2,1-2H3/p+1 |
| InChIKey | DADOSGVZTOCGNG-UHFFFAOYSA-O |
| XLogP | 1.28 |
| TPSA | 45.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.49 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |