C22H30N3O+ — CID 6600908
N-benzyl-N-methyl-2-[(3S)-3-methyl-4-(3-methylphenyl)piperazin-1-ium-1-yl]acetamide (PubChem CID 6600908) has the molecular formula C22H30N3O+ and a molecular weight of 352.50 g/mol. Its IUPAC name is N-benzyl-N-methyl-2-[(3S)-3-methyl-4-(3-methylphenyl)piperazin-1-ium-1-yl]acetamide.
| Compound Name | N-benzyl-N-methyl-2-[(3S)-3-methyl-4-(3-methylphenyl)piperazin-1-ium-1-yl]acetamide |
|---|---|
| PubChem CID | 6600908 |
| Molecular Formula | C22H30N3O+ |
| Molecular Weight | 352.50 g/mol |
| Exact Mass | 352.24 |
| IUPAC Name | N-benzyl-N-methyl-2-[(3S)-3-methyl-4-(3-methylphenyl)piperazin-1-ium-1-yl]acetamide |
| SMILES | Cc1cccc(N2CC[NH+](CC(=O)N(C)Cc3ccccc3)C[C@@H]2C)c1 |
| InChI | InChI=1S/C22H29N3O/c1-18-8-7-11-21(14-18)25-13-12-24(15-19(25)2)17-22(26)23(3)16-20-9-5-4-6-10-20/h4-11,14,19H,12-13,15-17H2,1-3H3/p+1/t19-/m0/s1 |
| InChIKey | UGISPHVBGHYQMT-IBGZPJMESA-O |
| XLogP | 1.75 |
| TPSA | 27.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.50 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |