C26H30N3O+ — CID 8688802
N,N-dibenzyl-2-(4-phenylpiperazin-1-ium-1-yl)acetamide (PubChem CID 8688802) has the molecular formula C26H30N3O+ and a molecular weight of 400.55 g/mol. Its IUPAC name is N,N-dibenzyl-2-(4-phenylpiperazin-1-ium-1-yl)acetamide.
| Compound Name | N,N-dibenzyl-2-(4-phenylpiperazin-1-ium-1-yl)acetamide |
|---|---|
| PubChem CID | 8688802 |
| Molecular Formula | C26H30N3O+ |
| Molecular Weight | 400.55 g/mol |
| Exact Mass | 400.24 |
| IUPAC Name | N,N-dibenzyl-2-(4-phenylpiperazin-1-ium-1-yl)acetamide |
| SMILES | O=C(C[NH+]1CCN(c2ccccc2)CC1)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C26H29N3O/c30-26(22-27-16-18-28(19-17-27)25-14-8-3-9-15-25)29(20-23-10-4-1-5-11-23)21-24-12-6-2-7-13-24/h1-15H,16-22H2/p+1 |
| InChIKey | KTXOYMVDXMEZAC-UHFFFAOYSA-O |
| XLogP | 2.62 |
| TPSA | 27.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.55 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |