C21H27N3O3S — CID 9212626
2,5-dimethyl-N-[(Z)-[(1R)-1-morpholin-4-yl-1-phenylpropan-2-ylidene]amino]benzenesulfonamide (PubChem CID 9212626) has the molecular formula C21H27N3O3S and a molecular weight of 401.53 g/mol. Its IUPAC name is 2,5-dimethyl-N-[(Z)-[(1R)-1-morpholin-4-yl-1-phenylpropan-2-ylidene]amino]benzenesulfonamide.
| Compound Name | 2,5-dimethyl-N-[(Z)-[(1R)-1-morpholin-4-yl-1-phenylpropan-2-ylidene]amino]benzenesulfonamide |
|---|---|
| PubChem CID | 9212626 |
| Molecular Formula | C21H27N3O3S |
| Molecular Weight | 401.53 g/mol |
| Exact Mass | 401.18 |
| IUPAC Name | 2,5-dimethyl-N-[(Z)-[(1R)-1-morpholin-4-yl-1-phenylpropan-2-ylidene]amino]benzenesulfonamide |
| SMILES | C/C(=N/NS(=O)(=O)c1cc(C)ccc1C)[C@@H](c1ccccc1)N1CCOCC1 |
| InChI | InChI=1S/C21H27N3O3S/c1-16-9-10-17(2)20(15-16)28(25,26)23-22-18(3)21(19-7-5-4-6-8-19)24-11-13-27-14-12-24/h4-10,15,21,23H,11-14H2,1-3H3/b22-18-/t21-/m0/s1 |
| InChIKey | RJDIUIKPFNKGPO-UEBMVEOSSA-N |
| XLogP | 3.03 |
| TPSA | 71.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.53 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|