C15H24N2O2S — CID 9217508
2,5-dimethyl-N-[(Z)-5-methylhexan-2-ylideneamino]benzenesulfonamide (PubChem CID 9217508) has the molecular formula C15H24N2O2S and a molecular weight of 296.44 g/mol. Its IUPAC name is 2,5-dimethyl-N-[(Z)-5-methylhexan-2-ylideneamino]benzenesulfonamide.
| Compound Name | 2,5-dimethyl-N-[(Z)-5-methylhexan-2-ylideneamino]benzenesulfonamide |
|---|---|
| PubChem CID | 9217508 |
| Molecular Formula | C15H24N2O2S |
| Molecular Weight | 296.44 g/mol |
| Exact Mass | 296.16 |
| IUPAC Name | 2,5-dimethyl-N-[(Z)-5-methylhexan-2-ylideneamino]benzenesulfonamide |
| SMILES | C/C(CCC(C)C)=N/NS(=O)(=O)c1cc(C)ccc1C |
| InChI | InChI=1S/C15H24N2O2S/c1-11(2)6-9-14(5)16-17-20(18,19)15-10-12(3)7-8-13(15)4/h7-8,10-11,17H,6,9H2,1-5H3/b16-14- |
| InChIKey | BJLAWAJGAIKYSQ-PEZBUJJGSA-N |
| XLogP | 3.39 |
| TPSA | 58.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.44 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|