C18H20ClFN2O2S — CID 19629622
N-[(Z)-[4-chloro-1-(4-fluorophenyl)butylidene]amino]-2,5-dimethylbenzenesulfonamide (PubChem CID 19629622) has the molecular formula C18H20ClFN2O2S and a molecular weight of 382.89 g/mol. Its IUPAC name is N-[(Z)-[4-chloro-1-(4-fluorophenyl)butylidene]amino]-2,5-dimethylbenzenesulfonamide.
| Compound Name | N-[(Z)-[4-chloro-1-(4-fluorophenyl)butylidene]amino]-2,5-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 19629622 |
| Molecular Formula | C18H20ClFN2O2S |
| Molecular Weight | 382.89 g/mol |
| Exact Mass | 382.09 |
| IUPAC Name | N-[(Z)-[4-chloro-1-(4-fluorophenyl)butylidene]amino]-2,5-dimethylbenzenesulfonamide |
| SMILES | Cc1ccc(C)c(S(=O)(=O)N/N=C(/CCCCl)c2ccc(F)cc2)c1 |
| InChI | InChI=1S/C18H20ClFN2O2S/c1-13-5-6-14(2)18(12-13)25(23,24)22-21-17(4-3-11-19)15-7-9-16(20)10-8-15/h5-10,12,22H,3-4,11H2,1-2H3/b21-17- |
| InChIKey | JSVPYZUTEAHXQT-FXBPSFAMSA-N |
| XLogP | 4.14 |
| TPSA | 58.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.89 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|