C20H21F3N2O4 — CID 9220530
3-(2-methoxyphenyl)-N-methyl-N-[2-oxo-2-[4-(trifluoromethoxy)anilino]ethyl]propanamide (PubChem CID 9220530) has the molecular formula C20H21F3N2O4 and a molecular weight of 410.39 g/mol. Its IUPAC name is 3-(2-methoxyphenyl)-N-methyl-N-[2-oxo-2-[4-(trifluoromethoxy)anilino]ethyl]propanamide.
| Compound Name | 3-(2-methoxyphenyl)-N-methyl-N-[2-oxo-2-[4-(trifluoromethoxy)anilino]ethyl]propanamide |
|---|---|
| PubChem CID | 9220530 |
| Molecular Formula | C20H21F3N2O4 |
| Molecular Weight | 410.39 g/mol |
| Exact Mass | 410.15 |
| IUPAC Name | 3-(2-methoxyphenyl)-N-methyl-N-[2-oxo-2-[4-(trifluoromethoxy)anilino]ethyl]propanamide |
| SMILES | COc1ccccc1CCC(=O)N(C)CC(=O)Nc1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C20H21F3N2O4/c1-25(19(27)12-7-14-5-3-4-6-17(14)28-2)13-18(26)24-15-8-10-16(11-9-15)29-20(21,22)23/h3-6,8-11H,7,12-13H2,1-2H3,(H,24,26) |
| InChIKey | PAOXKWMGXSRKEC-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.39 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |