C14H19BrN2O — CID 922187
3-bromo-N-(3,3-dimethylbutan-2-ylideneamino)-4-methylbenzamide (PubChem CID 922187) has the molecular formula C14H19BrN2O and a molecular weight of 311.22 g/mol. Its IUPAC name is 3-bromo-N-(3,3-dimethylbutan-2-ylideneamino)-4-methylbenzamide.
| Compound Name | 3-bromo-N-(3,3-dimethylbutan-2-ylideneamino)-4-methylbenzamide |
|---|---|
| PubChem CID | 922187 |
| Molecular Formula | C14H19BrN2O |
| Molecular Weight | 311.22 g/mol |
| Exact Mass | 310.07 |
| IUPAC Name | 3-bromo-N-(3,3-dimethylbutan-2-ylideneamino)-4-methylbenzamide |
| SMILES | CC(=NNC(=O)c1ccc(C)c(Br)c1)C(C)(C)C |
| InChI | InChI=1S/C14H19BrN2O/c1-9-6-7-11(8-12(9)15)13(18)17-16-10(2)14(3,4)5/h6-8H,1-5H3,(H,17,18) |
| InChIKey | AVHDOODKQBSTLQ-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.22 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|