C21H19ClFN3OS — CID 9225925
(E)-1-[4-(1,3-benzothiazol-2-ylmethyl)piperazin-1-yl]-3-(2-chloro-6-fluorophenyl)prop-2-en-1-one (PubChem CID 9225925) has the molecular formula C21H19ClFN3OS and a molecular weight of 415.92 g/mol. Its IUPAC name is (E)-1-[4-(1,3-benzothiazol-2-ylmethyl)piperazin-1-yl]-3-(2-chloro-6-fluorophenyl)prop-2-en-1-one.
| Compound Name | (E)-1-[4-(1,3-benzothiazol-2-ylmethyl)piperazin-1-yl]-3-(2-chloro-6-fluorophenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 9225925 |
| Molecular Formula | C21H19ClFN3OS |
| Molecular Weight | 415.92 g/mol |
| Exact Mass | 415.09 |
| IUPAC Name | (E)-1-[4-(1,3-benzothiazol-2-ylmethyl)piperazin-1-yl]-3-(2-chloro-6-fluorophenyl)prop-2-en-1-one |
| SMILES | O=C(/C=C/c1c(F)cccc1Cl)N1CCN(Cc2nc3ccccc3s2)CC1 |
| InChI | InChI=1S/C21H19ClFN3OS/c22-16-4-3-5-17(23)15(16)8-9-21(27)26-12-10-25(11-13-26)14-20-24-18-6-1-2-7-19(18)28-20/h1-9H,10-14H2/b9-8+ |
| InChIKey | CZOBCQMMKYUGFJ-CMDGGOBGSA-N |
| XLogP | 4.45 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.92 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|