C21H20ClFN3OS+ — CID 9238256
(E)-1-[4-(1,3-benzothiazol-2-ylmethyl)piperazin-4-ium-1-yl]-3-(3-chloro-4-fluorophenyl)prop-2-en-1-one (PubChem CID 9238256) has the molecular formula C21H20ClFN3OS+ and a molecular weight of 416.93 g/mol. Its IUPAC name is (E)-1-[4-(1,3-benzothiazol-2-ylmethyl)piperazin-4-ium-1-yl]-3-(3-chloro-4-fluorophenyl)prop-2-en-1-one.
| Compound Name | (E)-1-[4-(1,3-benzothiazol-2-ylmethyl)piperazin-4-ium-1-yl]-3-(3-chloro-4-fluorophenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 9238256 |
| Molecular Formula | C21H20ClFN3OS+ |
| Molecular Weight | 416.93 g/mol |
| Exact Mass | 416.10 |
| IUPAC Name | (E)-1-[4-(1,3-benzothiazol-2-ylmethyl)piperazin-4-ium-1-yl]-3-(3-chloro-4-fluorophenyl)prop-2-en-1-one |
| SMILES | O=C(/C=C/c1ccc(F)c(Cl)c1)N1CC[NH+](Cc2nc3ccccc3s2)CC1 |
| InChI | InChI=1S/C21H19ClFN3OS/c22-16-13-15(5-7-17(16)23)6-8-21(27)26-11-9-25(10-12-26)14-20-24-18-3-1-2-4-19(18)28-20/h1-8,13H,9-12,14H2/p+1/b8-6+ |
| InChIKey | LUYQUOJXHLRTBR-SOFGYWHQSA-O |
| XLogP | 3.03 |
| TPSA | 37.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.93 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|