C20H23N4O+ — CID 9226035
2-(1H-indol-3-yl)-1-[4-(pyridin-4-ylmethyl)piperazin-4-ium-1-yl]ethanone (PubChem CID 9226035) has the molecular formula C20H23N4O+ and a molecular weight of 335.43 g/mol. Its IUPAC name is 2-(1H-indol-3-yl)-1-[4-(pyridin-4-ylmethyl)piperazin-4-ium-1-yl]ethanone.
| Compound Name | 2-(1H-indol-3-yl)-1-[4-(pyridin-4-ylmethyl)piperazin-4-ium-1-yl]ethanone |
|---|---|
| PubChem CID | 9226035 |
| Molecular Formula | C20H23N4O+ |
| Molecular Weight | 335.43 g/mol |
| Exact Mass | 335.19 |
| IUPAC Name | 2-(1H-indol-3-yl)-1-[4-(pyridin-4-ylmethyl)piperazin-4-ium-1-yl]ethanone |
| SMILES | O=C(Cc1c[nH]c2ccccc12)N1CC[NH+](Cc2ccncc2)CC1 |
| InChI | InChI=1S/C20H22N4O/c25-20(13-17-14-22-19-4-2-1-3-18(17)19)24-11-9-23(10-12-24)15-16-5-7-21-8-6-16/h1-8,14,22H,9-13,15H2/p+1 |
| InChIKey | UOBILEGNCBUVCP-UHFFFAOYSA-O |
| XLogP | 1.03 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.43 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |