C15H15N5O2S — CID 9230693
3-[(1-propyltetrazol-5-yl)methyl]-2λ6-thia-3-azatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaene 2,2-dioxide (PubChem CID 9230693) has the molecular formula C15H15N5O2S and a molecular weight of 329.39 g/mol. Its IUPAC name is 3-[(1-propyltetrazol-5-yl)methyl]-2λ6-thia-3-azatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaene 2,2-dioxide.
| Compound Name | 3-[(1-propyltetrazol-5-yl)methyl]-2λ6-thia-3-azatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaene 2,2-dioxide |
|---|---|
| PubChem CID | 9230693 |
| Molecular Formula | C15H15N5O2S |
| Molecular Weight | 329.39 g/mol |
| Exact Mass | 329.09 |
| IUPAC Name | 3-[(1-propyltetrazol-5-yl)methyl]-2λ6-thia-3-azatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaene 2,2-dioxide |
| SMILES | CCCn1nnnc1CN1c2cccc3cccc(c23)S1(=O)=O |
| InChI | InChI=1S/C15H15N5O2S/c1-2-9-19-14(16-17-18-19)10-20-12-7-3-5-11-6-4-8-13(15(11)12)23(20,21)22/h3-8H,2,9-10H2,1H3 |
| InChIKey | MEAXJOYWISBEEQ-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 80.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.39 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |