C16H19F3N6OS — CID 9231136
2-(1-methyltetrazol-5-yl)sulfanyl-N-[2-piperidin-1-yl-5-(trifluoromethyl)phenyl]acetamide (PubChem CID 9231136) has the molecular formula C16H19F3N6OS and a molecular weight of 400.43 g/mol. Its IUPAC name is 2-(1-methyltetrazol-5-yl)sulfanyl-N-[2-piperidin-1-yl-5-(trifluoromethyl)phenyl]acetamide.
| Compound Name | 2-(1-methyltetrazol-5-yl)sulfanyl-N-[2-piperidin-1-yl-5-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 9231136 |
| Molecular Formula | C16H19F3N6OS |
| Molecular Weight | 400.43 g/mol |
| Exact Mass | 400.13 |
| IUPAC Name | 2-(1-methyltetrazol-5-yl)sulfanyl-N-[2-piperidin-1-yl-5-(trifluoromethyl)phenyl]acetamide |
| SMILES | Cn1nnnc1SCC(=O)Nc1cc(C(F)(F)F)ccc1N1CCCCC1 |
| InChI | InChI=1S/C16H19F3N6OS/c1-24-15(21-22-23-24)27-10-14(26)20-12-9-11(16(17,18)19)5-6-13(12)25-7-3-2-4-8-25/h5-6,9H,2-4,7-8,10H2,1H3,(H,20,26) |
| InChIKey | RWWQAQIFQIWHLN-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 75.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.43 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |