C17H22N4OS2 — CID 9232243
4-[2,5-dimethyl-1-(1,3-thiazol-2-yl)pyrrol-3-yl]-N-(3-ethoxypropyl)-1,3-thiazol-2-amine (PubChem CID 9232243) has the molecular formula C17H22N4OS2 and a molecular weight of 362.52 g/mol. Its IUPAC name is 4-[2,5-dimethyl-1-(1,3-thiazol-2-yl)pyrrol-3-yl]-N-(3-ethoxypropyl)-1,3-thiazol-2-amine.
| Compound Name | 4-[2,5-dimethyl-1-(1,3-thiazol-2-yl)pyrrol-3-yl]-N-(3-ethoxypropyl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 9232243 |
| Molecular Formula | C17H22N4OS2 |
| Molecular Weight | 362.52 g/mol |
| Exact Mass | 362.12 |
| IUPAC Name | 4-[2,5-dimethyl-1-(1,3-thiazol-2-yl)pyrrol-3-yl]-N-(3-ethoxypropyl)-1,3-thiazol-2-amine |
| SMILES | CCOCCCNc1nc(-c2cc(C)n(-c3nccs3)c2C)cs1 |
| InChI | InChI=1S/C17H22N4OS2/c1-4-22-8-5-6-18-16-20-15(11-24-16)14-10-12(2)21(13(14)3)17-19-7-9-23-17/h7,9-11H,4-6,8H2,1-3H3,(H,18,20) |
| InChIKey | OYKKSIIBLALFIY-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 51.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.52 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|