C18H25N5O2S2 — CID 9233030
methyl (2S)-4-[[4-(4-butylphenyl)-5-sulfanylidenetetrazol-1-yl]methyl]thiomorpholine-2-carboxylate (PubChem CID 9233030) has the molecular formula C18H25N5O2S2 and a molecular weight of 407.57 g/mol. Its IUPAC name is methyl (2S)-4-[[4-(4-butylphenyl)-5-sulfanylidenetetrazol-1-yl]methyl]thiomorpholine-2-carboxylate.
| Compound Name | methyl (2S)-4-[[4-(4-butylphenyl)-5-sulfanylidenetetrazol-1-yl]methyl]thiomorpholine-2-carboxylate |
|---|---|
| PubChem CID | 9233030 |
| Molecular Formula | C18H25N5O2S2 |
| Molecular Weight | 407.57 g/mol |
| Exact Mass | 407.14 |
| IUPAC Name | methyl (2S)-4-[[4-(4-butylphenyl)-5-sulfanylidenetetrazol-1-yl]methyl]thiomorpholine-2-carboxylate |
| SMILES | CCCCc1ccc(-n2nnn(CN3CCS[C@H](C(=O)OC)C3)c2=S)cc1 |
| InChI | InChI=1S/C18H25N5O2S2/c1-3-4-5-14-6-8-15(9-7-14)23-18(26)22(19-20-23)13-21-10-11-27-16(12-21)17(24)25-2/h6-9,16H,3-5,10-13H2,1-2H3/t16-/m0/s1 |
| InChIKey | PSRLPHMANVMVSW-INIZCTEOSA-N |
| XLogP | 2.69 |
| TPSA | 65.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.57 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|