C22H22N2O2 — CID 9236237
(3R)-3-phenyl-1-[(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)methyl]pyrrolidine-2,5-dione (PubChem CID 9236237) has the molecular formula C22H22N2O2 and a molecular weight of 346.43 g/mol. Its IUPAC name is (3R)-3-phenyl-1-[(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)methyl]pyrrolidine-2,5-dione.
| Compound Name | (3R)-3-phenyl-1-[(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)methyl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 9236237 |
| Molecular Formula | C22H22N2O2 |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.17 |
| IUPAC Name | (3R)-3-phenyl-1-[(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)methyl]pyrrolidine-2,5-dione |
| SMILES | O=C1C[C@H](c2ccccc2)C(=O)N1CN1CC=C(c2ccccc2)CC1 |
| InChI | InChI=1S/C22H22N2O2/c25-21-15-20(19-9-5-2-6-10-19)22(26)24(21)16-23-13-11-18(12-14-23)17-7-3-1-4-8-17/h1-11,20H,12-16H2/t20-/m1/s1 |
| InChIKey | ZQBIFSMYSFOSKW-HXUWFJFHSA-N |
| XLogP | 3.28 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|