C17H16F3N3O3 — CID 9236250
1-[(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)methyl]-3-(2,2,2-trifluoroethyl)imidazolidine-2,4,5-trione (PubChem CID 9236250) has the molecular formula C17H16F3N3O3 and a molecular weight of 367.33 g/mol. Its IUPAC name is 1-[(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)methyl]-3-(2,2,2-trifluoroethyl)imidazolidine-2,4,5-trione.
| Compound Name | 1-[(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)methyl]-3-(2,2,2-trifluoroethyl)imidazolidine-2,4,5-trione |
|---|---|
| PubChem CID | 9236250 |
| Molecular Formula | C17H16F3N3O3 |
| Molecular Weight | 367.33 g/mol |
| Exact Mass | 367.11 |
| IUPAC Name | 1-[(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)methyl]-3-(2,2,2-trifluoroethyl)imidazolidine-2,4,5-trione |
| SMILES | O=C1C(=O)N(CC(F)(F)F)C(=O)N1CN1CC=C(c2ccccc2)CC1 |
| InChI | InChI=1S/C17H16F3N3O3/c18-17(19,20)10-22-14(24)15(25)23(16(22)26)11-21-8-6-13(7-9-21)12-4-2-1-3-5-12/h1-6H,7-11H2 |
| InChIKey | ZUJCZYWFURYTFB-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 60.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.33 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|