C19H27N4O5S+ — CID 9238771
1-[[4-(2,4-dimethylphenyl)sulfonylpiperazin-1-ium-1-yl]methyl]-3-propylimidazolidine-2,4,5-trione (PubChem CID 9238771) has the molecular formula C19H27N4O5S+ and a molecular weight of 423.52 g/mol. Its IUPAC name is 1-[[4-(2,4-dimethylphenyl)sulfonylpiperazin-1-ium-1-yl]methyl]-3-propylimidazolidine-2,4,5-trione.
| Compound Name | 1-[[4-(2,4-dimethylphenyl)sulfonylpiperazin-1-ium-1-yl]methyl]-3-propylimidazolidine-2,4,5-trione |
|---|---|
| PubChem CID | 9238771 |
| Molecular Formula | C19H27N4O5S+ |
| Molecular Weight | 423.52 g/mol |
| Exact Mass | 423.17 |
| IUPAC Name | 1-[[4-(2,4-dimethylphenyl)sulfonylpiperazin-1-ium-1-yl]methyl]-3-propylimidazolidine-2,4,5-trione |
| SMILES | CCCN1C(=O)C(=O)N(C[NH+]2CCN(S(=O)(=O)c3ccc(C)cc3C)CC2)C1=O |
| InChI | InChI=1S/C19H26N4O5S/c1-4-7-22-17(24)18(25)23(19(22)26)13-20-8-10-21(11-9-20)29(27,28)16-6-5-14(2)12-15(16)3/h5-6,12H,4,7-11,13H2,1-3H3/p+1 |
| InChIKey | YHIPQDALGRGAPG-UHFFFAOYSA-O |
| XLogP | -0.65 |
| TPSA | 99.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.52 |
| LogP ≤ 5 | -0.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|