C15H21BrN4OS2 — CID 9239813
3-[[(5-bromo-2-methoxyphenyl)methyl-methylamino]methyl]-5-(propylamino)-1,3,4-thiadiazole-2-thione (PubChem CID 9239813) has the molecular formula C15H21BrN4OS2 and a molecular weight of 417.40 g/mol. Its IUPAC name is 3-[[(5-bromo-2-methoxyphenyl)methyl-methylamino]methyl]-5-(propylamino)-1,3,4-thiadiazole-2-thione.
| Compound Name | 3-[[(5-bromo-2-methoxyphenyl)methyl-methylamino]methyl]-5-(propylamino)-1,3,4-thiadiazole-2-thione |
|---|---|
| PubChem CID | 9239813 |
| Molecular Formula | C15H21BrN4OS2 |
| Molecular Weight | 417.40 g/mol |
| Exact Mass | 416.03 |
| IUPAC Name | 3-[[(5-bromo-2-methoxyphenyl)methyl-methylamino]methyl]-5-(propylamino)-1,3,4-thiadiazole-2-thione |
| SMILES | CCCNc1nn(CN(C)Cc2cc(Br)ccc2OC)c(=S)s1 |
| InChI | InChI=1S/C15H21BrN4OS2/c1-4-7-17-14-18-20(15(22)23-14)10-19(2)9-11-8-12(16)5-6-13(11)21-3/h5-6,8H,4,7,9-10H2,1-3H3,(H,17,18) |
| InChIKey | ZOABGLVJVPPERG-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 42.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.40 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|