C19H21ClN5O4+ — CID 9241750
[5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]methyl-cyclopropyl-[(2,4,5-trioxo-3-propan-2-ylimidazolidin-1-yl)methyl]azanium (PubChem CID 9241750) has the molecular formula C19H21ClN5O4+ and a molecular weight of 418.86 g/mol. Its IUPAC name is [5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]methyl-cyclopropyl-[(2,4,5-trioxo-3-propan-2-ylimidazolidin-1-yl)methyl]azanium.
| Compound Name | [5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]methyl-cyclopropyl-[(2,4,5-trioxo-3-propan-2-ylimidazolidin-1-yl)methyl]azanium |
|---|---|
| PubChem CID | 9241750 |
| Molecular Formula | C19H21ClN5O4+ |
| Molecular Weight | 418.86 g/mol |
| Exact Mass | 418.13 |
| IUPAC Name | [5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]methyl-cyclopropyl-[(2,4,5-trioxo-3-propan-2-ylimidazolidin-1-yl)methyl]azanium |
| SMILES | CC(C)N1C(=O)C(=O)N(C[NH+](Cc2nnc(-c3ccc(Cl)cc3)o2)C2CC2)C1=O |
| InChI | InChI=1S/C19H20ClN5O4/c1-11(2)25-18(27)17(26)24(19(25)28)10-23(14-7-8-14)9-15-21-22-16(29-15)12-3-5-13(20)6-4-12/h3-6,11,14H,7-10H2,1-2H3/p+1 |
| InChIKey | DARMFZOKOZGYQJ-UHFFFAOYSA-O |
| XLogP | 1.09 |
| TPSA | 101.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.86 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|