C17H19ClN5O4+ — CID 9241944
[5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]methyl-[(3-methyl-2,4,5-trioxoimidazolidin-1-yl)methyl]-propan-2-ylazanium (PubChem CID 9241944) has the molecular formula C17H19ClN5O4+ and a molecular weight of 392.82 g/mol. Its IUPAC name is [5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]methyl-[(3-methyl-2,4,5-trioxoimidazolidin-1-yl)methyl]-propan-2-ylazanium.
| Compound Name | [5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]methyl-[(3-methyl-2,4,5-trioxoimidazolidin-1-yl)methyl]-propan-2-ylazanium |
|---|---|
| PubChem CID | 9241944 |
| Molecular Formula | C17H19ClN5O4+ |
| Molecular Weight | 392.82 g/mol |
| Exact Mass | 392.11 |
| IUPAC Name | [5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]methyl-[(3-methyl-2,4,5-trioxoimidazolidin-1-yl)methyl]-propan-2-ylazanium |
| SMILES | CC(C)[NH+](Cc1nnc(-c2ccc(Cl)cc2)o1)CN1C(=O)C(=O)N(C)C1=O |
| InChI | InChI=1S/C17H18ClN5O4/c1-10(2)22(9-23-16(25)15(24)21(3)17(23)26)8-13-19-20-14(27-13)11-4-6-12(18)7-5-11/h4-7,10H,8-9H2,1-3H3/p+1 |
| InChIKey | MYPKUWORKGJGRN-UHFFFAOYSA-O |
| XLogP | 0.56 |
| TPSA | 101.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.82 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|