C23H23ClN3O2+ — CID 9241821
[5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]methyl-[(2-hydroxynaphthalen-1-yl)methyl]-propan-2-ylazanium (PubChem CID 9241821) has the molecular formula C23H23ClN3O2+ and a molecular weight of 408.91 g/mol. Its IUPAC name is [5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]methyl-[(2-hydroxynaphthalen-1-yl)methyl]-propan-2-ylazanium.
| Compound Name | [5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]methyl-[(2-hydroxynaphthalen-1-yl)methyl]-propan-2-ylazanium |
|---|---|
| PubChem CID | 9241821 |
| Molecular Formula | C23H23ClN3O2+ |
| Molecular Weight | 408.91 g/mol |
| Exact Mass | 408.15 |
| IUPAC Name | [5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]methyl-[(2-hydroxynaphthalen-1-yl)methyl]-propan-2-ylazanium |
| SMILES | CC(C)[NH+](Cc1nnc(-c2ccc(Cl)cc2)o1)Cc1c(O)ccc2ccccc12 |
| InChI | InChI=1S/C23H22ClN3O2/c1-15(2)27(13-20-19-6-4-3-5-16(19)9-12-21(20)28)14-22-25-26-23(29-22)17-7-10-18(24)11-8-17/h3-12,15,28H,13-14H2,1-2H3/p+1 |
| InChIKey | KSNRNGHLPXBGQU-UHFFFAOYSA-O |
| XLogP | 4.24 |
| TPSA | 63.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.91 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|