C20H21N4O4S+ — CID 9242020
methyl-[[5-(3-nitrophenyl)-2-sulfanylidene-1,3,4-oxadiazol-3-yl]methyl]-[(4-prop-2-enoxyphenyl)methyl]azanium (PubChem CID 9242020) has the molecular formula C20H21N4O4S+ and a molecular weight of 413.48 g/mol. Its IUPAC name is methyl-[[5-(3-nitrophenyl)-2-sulfanylidene-1,3,4-oxadiazol-3-yl]methyl]-[(4-prop-2-enoxyphenyl)methyl]azanium.
| Compound Name | methyl-[[5-(3-nitrophenyl)-2-sulfanylidene-1,3,4-oxadiazol-3-yl]methyl]-[(4-prop-2-enoxyphenyl)methyl]azanium |
|---|---|
| PubChem CID | 9242020 |
| Molecular Formula | C20H21N4O4S+ |
| Molecular Weight | 413.48 g/mol |
| Exact Mass | 413.13 |
| IUPAC Name | methyl-[[5-(3-nitrophenyl)-2-sulfanylidene-1,3,4-oxadiazol-3-yl]methyl]-[(4-prop-2-enoxyphenyl)methyl]azanium |
| SMILES | C=CCOc1ccc(C[NH+](C)Cn2nc(-c3cccc([N+](=O)[O-])c3)oc2=S)cc1 |
| InChI | InChI=1S/C20H20N4O4S/c1-3-11-27-18-9-7-15(8-10-18)13-22(2)14-23-20(29)28-19(21-23)16-5-4-6-17(12-16)24(25)26/h3-10,12H,1,11,13-14H2,2H3/p+1 |
| InChIKey | YKYXGODGNMPHOO-UHFFFAOYSA-O |
| XLogP | 3.02 |
| TPSA | 87.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.48 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|