C19H21N4O5S+ — CID 9240848
(2,4-dimethoxyphenyl)methyl-methyl-[[5-(3-nitrophenyl)-2-sulfanylidene-1,3,4-oxadiazol-3-yl]methyl]azanium (PubChem CID 9240848) has the molecular formula C19H21N4O5S+ and a molecular weight of 417.47 g/mol. Its IUPAC name is (2,4-dimethoxyphenyl)methyl-methyl-[[5-(3-nitrophenyl)-2-sulfanylidene-1,3,4-oxadiazol-3-yl]methyl]azanium.
| Compound Name | (2,4-dimethoxyphenyl)methyl-methyl-[[5-(3-nitrophenyl)-2-sulfanylidene-1,3,4-oxadiazol-3-yl]methyl]azanium |
|---|---|
| PubChem CID | 9240848 |
| Molecular Formula | C19H21N4O5S+ |
| Molecular Weight | 417.47 g/mol |
| Exact Mass | 417.12 |
| IUPAC Name | (2,4-dimethoxyphenyl)methyl-methyl-[[5-(3-nitrophenyl)-2-sulfanylidene-1,3,4-oxadiazol-3-yl]methyl]azanium |
| SMILES | COc1ccc(C[NH+](C)Cn2nc(-c3cccc([N+](=O)[O-])c3)oc2=S)c(OC)c1 |
| InChI | InChI=1S/C19H20N4O5S/c1-21(11-14-7-8-16(26-2)10-17(14)27-3)12-22-19(29)28-18(20-22)13-5-4-6-15(9-13)23(24)25/h4-10H,11-12H2,1-3H3/p+1 |
| InChIKey | GBJMRBIYXMBQRP-UHFFFAOYSA-O |
| XLogP | 2.47 |
| TPSA | 97.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.47 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|