C20H16F2N2O3S — CID 9242802
methyl 2-[(6R)-6-(3-fluorophenyl)-3-(4-fluorophenyl)-4-methyl-2-sulfanylidene-1,6-dihydropyrimidin-5-yl]-2-oxoacetate (PubChem CID 9242802) has the molecular formula C20H16F2N2O3S and a molecular weight of 402.42 g/mol. Its IUPAC name is methyl 2-[(6R)-6-(3-fluorophenyl)-3-(4-fluorophenyl)-4-methyl-2-sulfanylidene-1,6-dihydropyrimidin-5-yl]-2-oxoacetate.
| Compound Name | methyl 2-[(6R)-6-(3-fluorophenyl)-3-(4-fluorophenyl)-4-methyl-2-sulfanylidene-1,6-dihydropyrimidin-5-yl]-2-oxoacetate |
|---|---|
| PubChem CID | 9242802 |
| Molecular Formula | C20H16F2N2O3S |
| Molecular Weight | 402.42 g/mol |
| Exact Mass | 402.08 |
| IUPAC Name | methyl 2-[(6R)-6-(3-fluorophenyl)-3-(4-fluorophenyl)-4-methyl-2-sulfanylidene-1,6-dihydropyrimidin-5-yl]-2-oxoacetate |
| SMILES | COC(=O)C(=O)C1=C(C)N(c2ccc(F)cc2)C(=S)N[C@@H]1c1cccc(F)c1 |
| InChI | InChI=1S/C20H16F2N2O3S/c1-11-16(18(25)19(26)27-2)17(12-4-3-5-14(22)10-12)23-20(28)24(11)15-8-6-13(21)7-9-15/h3-10,17H,1-2H3,(H,23,28)/t17-/m1/s1 |
| InChIKey | CZVXDFACAVTMAG-QGZVFWFLSA-N |
| XLogP | 3.42 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.42 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|