C19H19ClFN2O2+ — CID 9244103
(2-chloro-6-fluorophenyl)methyl-[[(3R)-2,5-dioxo-3-phenylpyrrolidin-1-yl]methyl]-methylazanium (PubChem CID 9244103) has the molecular formula C19H19ClFN2O2+ and a molecular weight of 361.82 g/mol. Its IUPAC name is (2-chloro-6-fluorophenyl)methyl-[[(3R)-2,5-dioxo-3-phenylpyrrolidin-1-yl]methyl]-methylazanium.
| Compound Name | (2-chloro-6-fluorophenyl)methyl-[[(3R)-2,5-dioxo-3-phenylpyrrolidin-1-yl]methyl]-methylazanium |
|---|---|
| PubChem CID | 9244103 |
| Molecular Formula | C19H19ClFN2O2+ |
| Molecular Weight | 361.82 g/mol |
| Exact Mass | 361.11 |
| IUPAC Name | (2-chloro-6-fluorophenyl)methyl-[[(3R)-2,5-dioxo-3-phenylpyrrolidin-1-yl]methyl]-methylazanium |
| SMILES | C[NH+](Cc1c(F)cccc1Cl)CN1C(=O)C[C@H](c2ccccc2)C1=O |
| InChI | InChI=1S/C19H18ClFN2O2/c1-22(11-15-16(20)8-5-9-17(15)21)12-23-18(24)10-14(19(23)25)13-6-3-2-4-7-13/h2-9,14H,10-12H2,1H3/p+1/t14-/m1/s1 |
| InChIKey | MKTALEGQUYEAKV-CQSZACIVSA-O |
| XLogP | 1.99 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.82 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|