C21H29N3O2 — CID 9244826
2-[[4-[(2-methylphenyl)methyl]piperazin-1-yl]methyl]-2-azaspiro[4.4]nonane-1,3-dione (PubChem CID 9244826) has the molecular formula C21H29N3O2 and a molecular weight of 355.48 g/mol. Its IUPAC name is 2-[[4-[(2-methylphenyl)methyl]piperazin-1-yl]methyl]-2-azaspiro[4.4]nonane-1,3-dione.
| Compound Name | 2-[[4-[(2-methylphenyl)methyl]piperazin-1-yl]methyl]-2-azaspiro[4.4]nonane-1,3-dione |
|---|---|
| PubChem CID | 9244826 |
| Molecular Formula | C21H29N3O2 |
| Molecular Weight | 355.48 g/mol |
| Exact Mass | 355.23 |
| IUPAC Name | 2-[[4-[(2-methylphenyl)methyl]piperazin-1-yl]methyl]-2-azaspiro[4.4]nonane-1,3-dione |
| SMILES | Cc1ccccc1CN1CCN(CN2C(=O)CC3(CCCC3)C2=O)CC1 |
| InChI | InChI=1S/C21H29N3O2/c1-17-6-2-3-7-18(17)15-22-10-12-23(13-11-22)16-24-19(25)14-21(20(24)26)8-4-5-9-21/h2-3,6-7H,4-5,8-16H2,1H3 |
| InChIKey | BNCFQGRJFWIOEW-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.48 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|