C19H18ClN5O3 — CID 9246011
N-[5-(4-tert-butylphenyl)-1H-1,2,4-triazol-3-yl]-4-chloro-3-nitrobenzamide (PubChem CID 9246011) has the molecular formula C19H18ClN5O3 and a molecular weight of 399.84 g/mol. Its IUPAC name is N-[5-(4-tert-butylphenyl)-1H-1,2,4-triazol-3-yl]-4-chloro-3-nitrobenzamide.
| Compound Name | N-[5-(4-tert-butylphenyl)-1H-1,2,4-triazol-3-yl]-4-chloro-3-nitrobenzamide |
|---|---|
| PubChem CID | 9246011 |
| Molecular Formula | C19H18ClN5O3 |
| Molecular Weight | 399.84 g/mol |
| Exact Mass | 399.11 |
| IUPAC Name | N-[5-(4-tert-butylphenyl)-1H-1,2,4-triazol-3-yl]-4-chloro-3-nitrobenzamide |
| SMILES | CC(C)(C)c1ccc(-c2nc(NC(=O)c3ccc(Cl)c([N+](=O)[O-])c3)n[nH]2)cc1 |
| InChI | InChI=1S/C19H18ClN5O3/c1-19(2,3)13-7-4-11(5-8-13)16-21-18(24-23-16)22-17(26)12-6-9-14(20)15(10-12)25(27)28/h4-10H,1-3H3,(H2,21,22,23,24,26) |
| InChIKey | OQMHODDYLXWGTD-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 113.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.84 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|