C23H17FN2O3 — CID 9246207
2-(4-benzoylphenoxy)-N-[(S)-cyano-(4-fluorophenyl)methyl]acetamide (PubChem CID 9246207) has the molecular formula C23H17FN2O3 and a molecular weight of 388.40 g/mol. Its IUPAC name is 2-(4-benzoylphenoxy)-N-[(S)-cyano-(4-fluorophenyl)methyl]acetamide.
| Compound Name | 2-(4-benzoylphenoxy)-N-[(S)-cyano-(4-fluorophenyl)methyl]acetamide |
|---|---|
| PubChem CID | 9246207 |
| Molecular Formula | C23H17FN2O3 |
| Molecular Weight | 388.40 g/mol |
| Exact Mass | 388.12 |
| IUPAC Name | 2-(4-benzoylphenoxy)-N-[(S)-cyano-(4-fluorophenyl)methyl]acetamide |
| SMILES | N#C[C@@H](NC(=O)COc1ccc(C(=O)c2ccccc2)cc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C23H17FN2O3/c24-19-10-6-16(7-11-19)21(14-25)26-22(27)15-29-20-12-8-18(9-13-20)23(28)17-4-2-1-3-5-17/h1-13,21H,15H2,(H,26,27)/t21-/m1/s1 |
| InChIKey | ZHKJFTWETMZRSQ-OAQYLSRUSA-N |
| XLogP | 3.82 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.40 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |