C19H18ClN5O2 — CID 9250773
2-chloro-4-nitro-N-[4-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)phenyl]aniline (PubChem CID 9250773) has the molecular formula C19H18ClN5O2 and a molecular weight of 383.84 g/mol. Its IUPAC name is 2-chloro-4-nitro-N-[4-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)phenyl]aniline.
| Compound Name | 2-chloro-4-nitro-N-[4-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)phenyl]aniline |
|---|---|
| PubChem CID | 9250773 |
| Molecular Formula | C19H18ClN5O2 |
| Molecular Weight | 383.84 g/mol |
| Exact Mass | 383.11 |
| IUPAC Name | 2-chloro-4-nitro-N-[4-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)phenyl]aniline |
| SMILES | O=[N+]([O-])c1ccc(Nc2ccc(-c3nnc4n3CCCCC4)cc2)c(Cl)c1 |
| InChI | InChI=1S/C19H18ClN5O2/c20-16-12-15(25(26)27)9-10-17(16)21-14-7-5-13(6-8-14)19-23-22-18-4-2-1-3-11-24(18)19/h5-10,12,21H,1-4,11H2 |
| InChIKey | RDBPJVTUEUNURV-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 85.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.84 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|