C13H20NO5P — CID 92525587
(NE)-N-[2-(3,4-dimethoxyphenyl)-1-[ethoxy(methyl)phosphoryl]ethylidene]hydroxylamine (PubChem CID 92525587) has the molecular formula C13H20NO5P and a molecular weight of 301.28 g/mol. Its IUPAC name is (NE)-N-[2-(3,4-dimethoxyphenyl)-1-[ethoxy(methyl)phosphoryl]ethylidene]hydroxylamine.
| Compound Name | (NE)-N-[2-(3,4-dimethoxyphenyl)-1-[ethoxy(methyl)phosphoryl]ethylidene]hydroxylamine |
|---|---|
| PubChem CID | 92525587 |
| Molecular Formula | C13H20NO5P |
| Molecular Weight | 301.28 g/mol |
| Exact Mass | 301.11 |
| IUPAC Name | (NE)-N-[2-(3,4-dimethoxyphenyl)-1-[ethoxy(methyl)phosphoryl]ethylidene]hydroxylamine |
| SMILES | CCO[P@@](C)(=O)/C(Cc1ccc(OC)c(OC)c1)=N/O |
| InChI | InChI=1S/C13H20NO5P/c1-5-19-20(4,16)13(14-15)9-10-6-7-11(17-2)12(8-10)18-3/h6-8,15H,5,9H2,1-4H3/b14-13+/t20-/m1/s1 |
| InChIKey | VWNKYRQEVGMBBB-FBRRREGBSA-N |
| XLogP | 2.98 |
| TPSA | 77.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.28 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|