C11H14N4O4S — CID 92527876
(2R,3S,4S,5S)-2-(hydroxymethyl)-5-(7-methylsulfanylpyrazolo[4,5-d]pyrimidin-1-yl)oxolane-3,4-diol (PubChem CID 92527876) has the molecular formula C11H14N4O4S and a molecular weight of 298.32 g/mol. Its IUPAC name is (2R,3S,4S,5S)-2-(hydroxymethyl)-5-(7-methylsulfanylpyrazolo[4,5-d]pyrimidin-1-yl)oxolane-3,4-diol.
| Compound Name | (2R,3S,4S,5S)-2-(hydroxymethyl)-5-(7-methylsulfanylpyrazolo[4,5-d]pyrimidin-1-yl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 92527876 |
| Molecular Formula | C11H14N4O4S |
| Molecular Weight | 298.32 g/mol |
| Exact Mass | 298.07 |
| IUPAC Name | (2R,3S,4S,5S)-2-(hydroxymethyl)-5-(7-methylsulfanylpyrazolo[4,5-d]pyrimidin-1-yl)oxolane-3,4-diol |
| SMILES | CSc1ncnc2cnn([C@H]3O[C@H](CO)[C@@H](O)[C@@H]3O)c12 |
| InChI | InChI=1S/C11H14N4O4S/c1-20-10-7-5(12-4-13-10)2-14-15(7)11-9(18)8(17)6(3-16)19-11/h2,4,6,8-9,11,16-18H,3H2,1H3/t6-,8-,9+,11+/m1/s1 |
| InChIKey | UDVOKMRDBBWTTQ-CNABLZDZSA-N |
| XLogP | -0.84 |
| TPSA | 113.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.32 |
| LogP ≤ 5 | -0.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |