C18H17ClO3 — CID 92529928
[(1R)-2-methyl-4-oxo-3-prop-2-enylcyclopent-2-en-1-yl] (Z)-3-(2-chlorophenyl)prop-2-enoate (PubChem CID 92529928) has the molecular formula C18H17ClO3 and a molecular weight of 316.78 g/mol. Its IUPAC name is [(1R)-2-methyl-4-oxo-3-prop-2-enylcyclopent-2-en-1-yl] (Z)-3-(2-chlorophenyl)prop-2-enoate.
| Compound Name | [(1R)-2-methyl-4-oxo-3-prop-2-enylcyclopent-2-en-1-yl] (Z)-3-(2-chlorophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 92529928 |
| Molecular Formula | C18H17ClO3 |
| Molecular Weight | 316.78 g/mol |
| Exact Mass | 316.09 |
| IUPAC Name | [(1R)-2-methyl-4-oxo-3-prop-2-enylcyclopent-2-en-1-yl] (Z)-3-(2-chlorophenyl)prop-2-enoate |
| SMILES | C=CCC1=C(C)[C@H](OC(=O)/C=C\c2ccccc2Cl)CC1=O |
| InChI | InChI=1S/C18H17ClO3/c1-3-6-14-12(2)17(11-16(14)20)22-18(21)10-9-13-7-4-5-8-15(13)19/h3-5,7-10,17H,1,6,11H2,2H3/b10-9-/t17-/m1/s1 |
| InChIKey | SDQAOKBAZBWUMM-DOOKAGJSSA-N |
| XLogP | 4.13 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.78 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|