C26H24N4O3 — CID 92530657
7-(2,3-dihydroindole-1-carbonyl)-5-[[(2R)-oxolan-2-yl]methyl]-2-phenylpyrazolo[4,3-c]pyridin-3-one (PubChem CID 92530657) has the molecular formula C26H24N4O3 and a molecular weight of 440.50 g/mol. Its IUPAC name is 7-(2,3-dihydroindole-1-carbonyl)-5-[[(2R)-oxolan-2-yl]methyl]-2-phenylpyrazolo[4,3-c]pyridin-3-one.
| Compound Name | 7-(2,3-dihydroindole-1-carbonyl)-5-[[(2R)-oxolan-2-yl]methyl]-2-phenylpyrazolo[4,3-c]pyridin-3-one |
|---|---|
| PubChem CID | 92530657 |
| Molecular Formula | C26H24N4O3 |
| Molecular Weight | 440.50 g/mol |
| Exact Mass | 440.18 |
| IUPAC Name | 7-(2,3-dihydroindole-1-carbonyl)-5-[[(2R)-oxolan-2-yl]methyl]-2-phenylpyrazolo[4,3-c]pyridin-3-one |
| SMILES | O=C(c1cn(C[C@H]2CCCO2)cc2c(=O)n(-c3ccccc3)nc1-2)N1CCc2ccccc21 |
| InChI | InChI=1S/C26H24N4O3/c31-25(29-13-12-18-7-4-5-11-23(18)29)21-16-28(15-20-10-6-14-33-20)17-22-24(21)27-30(26(22)32)19-8-2-1-3-9-19/h1-5,7-9,11,16-17,20H,6,10,12-15H2/t20-/m1/s1 |
| InChIKey | GWAIYYPWRAMFPT-HXUWFJFHSA-N |
| XLogP | 3.52 |
| TPSA | 69.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.50 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|