C16H22N4O4 — CID 92540253
N-(2-hydroxyethyl)-N'-[(Z)-[4-oxo-4-(2-phenylethylamino)butan-2-ylidene]amino]oxamide (PubChem CID 92540253) has the molecular formula C16H22N4O4 and a molecular weight of 334.38 g/mol. Its IUPAC name is N-(2-hydroxyethyl)-N'-[(Z)-[4-oxo-4-(2-phenylethylamino)butan-2-ylidene]amino]oxamide.
| Compound Name | N-(2-hydroxyethyl)-N'-[(Z)-[4-oxo-4-(2-phenylethylamino)butan-2-ylidene]amino]oxamide |
|---|---|
| PubChem CID | 92540253 |
| Molecular Formula | C16H22N4O4 |
| Molecular Weight | 334.38 g/mol |
| Exact Mass | 334.16 |
| IUPAC Name | N-(2-hydroxyethyl)-N'-[(Z)-[4-oxo-4-(2-phenylethylamino)butan-2-ylidene]amino]oxamide |
| SMILES | C/C(CC(=O)NCCc1ccccc1)=N/NC(=O)C(=O)NCCO |
| InChI | InChI=1S/C16H22N4O4/c1-12(19-20-16(24)15(23)18-9-10-21)11-14(22)17-8-7-13-5-3-2-4-6-13/h2-6,21H,7-11H2,1H3,(H,17,22)(H,18,23)(H,20,24)/b19-12- |
| InChIKey | IZHZWXSASIDPHF-UNOMPAQXSA-N |
| XLogP | -0.66 |
| TPSA | 119.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.38 |
| LogP ≤ 5 | -0.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|