C28H24N2O2 — CID 92543241
(3aS,5S,10bS)-10-benzyl-5-methyl-2-phenyl-3a,4,5,10b-tetrahydropyrrolo[3,4-a]carbazole-1,3-dione (PubChem CID 92543241) has the molecular formula C28H24N2O2 and a molecular weight of 420.51 g/mol. Its IUPAC name is (3aS,5S,10bS)-10-benzyl-5-methyl-2-phenyl-3a,4,5,10b-tetrahydropyrrolo[3,4-a]carbazole-1,3-dione.
| Compound Name | (3aS,5S,10bS)-10-benzyl-5-methyl-2-phenyl-3a,4,5,10b-tetrahydropyrrolo[3,4-a]carbazole-1,3-dione |
|---|---|
| PubChem CID | 92543241 |
| Molecular Formula | C28H24N2O2 |
| Molecular Weight | 420.51 g/mol |
| Exact Mass | 420.18 |
| IUPAC Name | (3aS,5S,10bS)-10-benzyl-5-methyl-2-phenyl-3a,4,5,10b-tetrahydropyrrolo[3,4-a]carbazole-1,3-dione |
| SMILES | C[C@H]1C[C@@H]2C(=O)N(c3ccccc3)C(=O)[C@@H]2c2c1c1ccccc1n2Cc1ccccc1 |
| InChI | InChI=1S/C28H24N2O2/c1-18-16-22-25(28(32)30(27(22)31)20-12-6-3-7-13-20)26-24(18)21-14-8-9-15-23(21)29(26)17-19-10-4-2-5-11-19/h2-15,18,22,25H,16-17H2,1H3/t18-,22-,25-/m0/s1 |
| InChIKey | AONNCUFLRUFGMU-PZGSVQSZSA-N |
| XLogP | 5.47 |
| TPSA | 42.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.51 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|