C22H31FN2O — CID 92568921
[(3R,3aS,9aR)-3-(3-fluorophenyl)-2,3,3a,4,5,6,7,8,9,9a-decahydropyrrolo[3,2-b]azocin-1-yl]-cyclohexylmethanone (PubChem CID 92568921) has the molecular formula C22H31FN2O and a molecular weight of 358.50 g/mol. Its IUPAC name is [(3R,3aS,9aR)-3-(3-fluorophenyl)-2,3,3a,4,5,6,7,8,9,9a-decahydropyrrolo[3,2-b]azocin-1-yl]-cyclohexylmethanone.
| Compound Name | [(3R,3aS,9aR)-3-(3-fluorophenyl)-2,3,3a,4,5,6,7,8,9,9a-decahydropyrrolo[3,2-b]azocin-1-yl]-cyclohexylmethanone |
|---|---|
| PubChem CID | 92568921 |
| Molecular Formula | C22H31FN2O |
| Molecular Weight | 358.50 g/mol |
| Exact Mass | 358.24 |
| IUPAC Name | [(3R,3aS,9aR)-3-(3-fluorophenyl)-2,3,3a,4,5,6,7,8,9,9a-decahydropyrrolo[3,2-b]azocin-1-yl]-cyclohexylmethanone |
| SMILES | O=C(C1CCCCC1)N1C[C@@H](c2cccc(F)c2)[C@@H]2NCCCCC[C@H]21 |
| InChI | InChI=1S/C22H31FN2O/c23-18-11-7-10-17(14-18)19-15-25(22(26)16-8-3-1-4-9-16)20-12-5-2-6-13-24-21(19)20/h7,10-11,14,16,19-21,24H,1-6,8-9,12-13,15H2/t19-,20+,21-/m0/s1 |
| InChIKey | JFDYDSUJXDOWLU-HBMCJLEFSA-N |
| XLogP | 4.23 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.50 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |