C27H33FN2O2 — CID 110148569
[(3R,3aS,9aS)-3-phenyl-2,3,3a,4,5,6,7,8,9,9a-decahydropyrrolo[3,2-b]azocin-1-yl]-[4-(3-fluorophenyl)oxan-4-yl]methanone (PubChem CID 110148569) has the molecular formula C27H33FN2O2 and a molecular weight of 436.57 g/mol. Its IUPAC name is [(3R,3aS,9aS)-3-phenyl-2,3,3a,4,5,6,7,8,9,9a-decahydropyrrolo[3,2-b]azocin-1-yl]-[4-(3-fluorophenyl)oxan-4-yl]methanone.
| Compound Name | [(3R,3aS,9aS)-3-phenyl-2,3,3a,4,5,6,7,8,9,9a-decahydropyrrolo[3,2-b]azocin-1-yl]-[4-(3-fluorophenyl)oxan-4-yl]methanone |
|---|---|
| PubChem CID | 110148569 |
| Molecular Formula | C27H33FN2O2 |
| Molecular Weight | 436.57 g/mol |
| Exact Mass | 436.25 |
| IUPAC Name | [(3R,3aS,9aS)-3-phenyl-2,3,3a,4,5,6,7,8,9,9a-decahydropyrrolo[3,2-b]azocin-1-yl]-[4-(3-fluorophenyl)oxan-4-yl]methanone |
| SMILES | O=C(N1C[C@@H](c2ccccc2)[C@@H]2NCCCCC[C@@H]21)C1(c2cccc(F)c2)CCOCC1 |
| InChI | InChI=1S/C27H33FN2O2/c28-22-11-7-10-21(18-22)27(13-16-32-17-14-27)26(31)30-19-23(20-8-3-1-4-9-20)25-24(30)12-5-2-6-15-29-25/h1,3-4,7-11,18,23-25,29H,2,5-6,12-17,19H2/t23-,24-,25-/m0/s1 |
| InChIKey | MSMSZRBKOHGUMJ-SDHOMARFSA-N |
| XLogP | 4.40 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.57 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |