C20H18N6O3S — CID 92572274
2-pyrazin-2-yl-5-[(3S)-1-quinolin-8-ylsulfonylpiperidin-3-yl]-1,3,4-oxadiazole (PubChem CID 92572274) has the molecular formula C20H18N6O3S and a molecular weight of 422.47 g/mol. Its IUPAC name is 2-pyrazin-2-yl-5-[(3S)-1-quinolin-8-ylsulfonylpiperidin-3-yl]-1,3,4-oxadiazole.
| Compound Name | 2-pyrazin-2-yl-5-[(3S)-1-quinolin-8-ylsulfonylpiperidin-3-yl]-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 92572274 |
| Molecular Formula | C20H18N6O3S |
| Molecular Weight | 422.47 g/mol |
| Exact Mass | 422.12 |
| IUPAC Name | 2-pyrazin-2-yl-5-[(3S)-1-quinolin-8-ylsulfonylpiperidin-3-yl]-1,3,4-oxadiazole |
| SMILES | O=S(=O)(c1cccc2cccnc12)N1CCC[C@H](c2nnc(-c3cnccn3)o2)C1 |
| InChI | InChI=1S/C20H18N6O3S/c27-30(28,17-7-1-4-14-5-2-8-23-18(14)17)26-11-3-6-15(13-26)19-24-25-20(29-19)16-12-21-9-10-22-16/h1-2,4-5,7-10,12,15H,3,6,11,13H2/t15-/m0/s1 |
| InChIKey | GMOPBHNFKSSOPW-HNNXBMFYSA-N |
| XLogP | 2.64 |
| TPSA | 114.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.47 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |