C21H19N5O3S — CID 92577744
2-pyridin-2-yl-5-[(3R)-1-quinolin-8-ylsulfonylpiperidin-3-yl]-1,3,4-oxadiazole (PubChem CID 92577744) has the molecular formula C21H19N5O3S and a molecular weight of 421.48 g/mol. Its IUPAC name is 2-pyridin-2-yl-5-[(3R)-1-quinolin-8-ylsulfonylpiperidin-3-yl]-1,3,4-oxadiazole.
| Compound Name | 2-pyridin-2-yl-5-[(3R)-1-quinolin-8-ylsulfonylpiperidin-3-yl]-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 92577744 |
| Molecular Formula | C21H19N5O3S |
| Molecular Weight | 421.48 g/mol |
| Exact Mass | 421.12 |
| IUPAC Name | 2-pyridin-2-yl-5-[(3R)-1-quinolin-8-ylsulfonylpiperidin-3-yl]-1,3,4-oxadiazole |
| SMILES | O=S(=O)(c1cccc2cccnc12)N1CCC[C@@H](c2nnc(-c3ccccn3)o2)C1 |
| InChI | InChI=1S/C21H19N5O3S/c27-30(28,18-10-3-6-15-7-4-12-23-19(15)18)26-13-5-8-16(14-26)20-24-25-21(29-20)17-9-1-2-11-22-17/h1-4,6-7,9-12,16H,5,8,13-14H2/t16-/m1/s1 |
| InChIKey | RHITXKPFHJUAFA-MRXNPFEDSA-N |
| XLogP | 3.25 |
| TPSA | 102.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.48 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |