About N-[(1S)-1-pyridin-2-yl-2-thiophen-3-ylethyl]-2-(1,2,4-triazol-1-yl)acetamide
N-[(1S)-1-pyridin-2-yl-2-thiophen-3-ylethyl]-2-(1,2,4-triazol-1-yl)acetamide (PubChem CID 92577329) has the molecular formula C15H15N5OS
and a molecular weight of 313.39 g/mol. Its IUPAC name is N-[(1S)-1-pyridin-2-yl-2-thiophen-3-ylethyl]-2-(1,2,4-triazol-1-yl)acetamide.
Molecular Properties
| Compound Name | N-[(1S)-1-pyridin-2-yl-2-thiophen-3-ylethyl]-2-(1,2,4-triazol-1-yl)acetamide |
| PubChem CID | 92577329 |
| Molecular Formula | C15H15N5OS |
| Molecular Weight | 313.39 g/mol |
| Exact Mass | 313.10 |
| IUPAC Name | N-[(1S)-1-pyridin-2-yl-2-thiophen-3-ylethyl]-2-(1,2,4-triazol-1-yl)acetamide |
| SMILES | O=C(Cn1cncn1)N[C@@H](Cc1ccsc1)c1ccccn1 |
| InChI | InChI=1S/C15H15N5OS/c21-15(8-20-11-16-10-18-20)19-14(7-12-4-6-22-9-12)13-3-1-2-5-17-13/h1-6,9-11,14H,7-8H2,(H,19,21)/t14-/m0/s1 |
| InChIKey | ZAHSKKWABQONDG-AWEZNQCLSA-N |
| XLogP | 1.83 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.39 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-[(1S)-1-pyridin-2-yl-2-thiophen-3-ylethyl]-2-(1,2,4-triazol-1-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(1S)-1-pyridin-2-yl-2-thiophen-3-ylethyl]-2-(1,2,4-triazol-1-yl)acetamide?
The IUPAC name of N-[(1S)-1-pyridin-2-yl-2-thiophen-3-ylethyl]-2-(1,2,4-triazol-1-yl)acetamide (CID 92577329) is N-[(1S)-1-pyridin-2-yl-2-thiophen-3-ylethyl]-2-(1,2,4-triazol-1-yl)acetamide.
What is the SMILES notation for N-[(1S)-1-pyridin-2-yl-2-thiophen-3-ylethyl]-2-(1,2,4-triazol-1-yl)acetamide?
The canonical SMILES for N-[(1S)-1-pyridin-2-yl-2-thiophen-3-ylethyl]-2-(1,2,4-triazol-1-yl)acetamide is O=C(Cn1cncn1)N[C@@H](Cc1ccsc1)c1ccccn1.
What is the InChIKey of N-[(1S)-1-pyridin-2-yl-2-thiophen-3-ylethyl]-2-(1,2,4-triazol-1-yl)acetamide?
The InChIKey is ZAHSKKWABQONDG-AWEZNQCLSA-N. The full InChI is InChI=1S/C15H15N5OS/c21-15(8-20-11-16-10-18-20)19-14(7-12-4-6-22-9-12)13-3-1-2-5-17-13/h1-6,9-11,14H,7-8H2,(H,19,21)/t14-/m0/s1.
What are the key properties of N-[(1S)-1-pyridin-2-yl-2-thiophen-3-ylethyl]-2-(1,2,4-triazol-1-yl)acetamide?
N-[(1S)-1-pyridin-2-yl-2-thiophen-3-ylethyl]-2-(1,2,4-triazol-1-yl)acetamide has a molecular weight of 313.39 g/mol, XLogP of 1.83, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(1S)-1-pyridin-2-yl-2-thiophen-3-ylethyl]-2-(1,2,4-triazol-1-yl)acetamide is sourced from PubChem (CID 92577329), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).